C14H21NO2 — CID 176803410
2-(3a,4,5,6,7,7a-hexahydro-3H-inden-5-ylamino)ethyl prop-2-enoate (PubChem CID 176803410) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(3a,4,5,6,7,7a-hexahydro-3H-inden-5-ylamino)ethyl prop-2-enoate.
| Compound Name | 2-(3a,4,5,6,7,7a-hexahydro-3H-inden-5-ylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 176803410 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(3a,4,5,6,7,7a-hexahydro-3H-inden-5-ylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC1CCC2C=CCC2C1 |
| InChI | InChI=1S/C14H21NO2/c1-2-14(16)17-9-8-15-13-7-6-11-4-3-5-12(11)10-13/h2-4,11-13,15H,1,5-10H2 |
| InChIKey | HOMAYYCERIREKO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|