C20H28O4 — CID 163836073
8-tricyclo[5.2.1.02,6]dec-3-enylmethyl 6-prop-2-enoyloxyhexanoate (PubChem CID 163836073) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]dec-3-enylmethyl 6-prop-2-enoyloxyhexanoate.
| Compound Name | 8-tricyclo[5.2.1.02,6]dec-3-enylmethyl 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 163836073 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]dec-3-enylmethyl 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OCCCCCC(=O)OCC1CC2CC1C1CC=CC21 |
| InChI | InChI=1S/C20H28O4/c1-2-19(21)23-10-5-3-4-9-20(22)24-13-15-11-14-12-18(15)17-8-6-7-16(14)17/h2,6-7,14-18H,1,3-5,8-13H2 |
| InChIKey | OHVYMVJFTMIPNP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|