C22H34O6 — CID 157126575
bis(2-methoxyethyl prop-2-enoate);tricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 157126575) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is bis(2-methoxyethyl prop-2-enoate);tricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | bis(2-methoxyethyl prop-2-enoate);tricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 157126575 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | bis(2-methoxyethyl prop-2-enoate);tricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C1=CC2C3CCC(C3)C2C1.C=CC(=O)OCCOC.C=CC(=O)OCCOC |
| InChI | InChI=1S/C10H14.2C6H10O3/c1-2-9-7-4-5-8(6-7)10(9)3-1;2*1-3-6(7)9-5-4-8-2/h1-2,7-10H,3-6H2;2*3H,1,4-5H2,2H3 |
| InChIKey | AIONMSGDVQQKPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|