C24H34O3 — CID 157391279
methanol;tricyclo[5.2.1.02,6]dec-3-ene;8-tricyclo[5.2.1.02,6]dec-4-enyl prop-2-enoate (PubChem CID 157391279) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is methanol;tricyclo[5.2.1.02,6]dec-3-ene;8-tricyclo[5.2.1.02,6]dec-4-enyl prop-2-enoate.
| Compound Name | methanol;tricyclo[5.2.1.02,6]dec-3-ene;8-tricyclo[5.2.1.02,6]dec-4-enyl prop-2-enoate |
|---|---|
| PubChem CID | 157391279 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | methanol;tricyclo[5.2.1.02,6]dec-3-ene;8-tricyclo[5.2.1.02,6]dec-4-enyl prop-2-enoate |
| SMILES | C1=CC2C3CCC(C3)C2C1.C=CC(=O)OC1CC2CC1C1C=CCC21.CO |
| InChI | InChI=1S/C13H16O2.C10H14.CH4O/c1-2-13(14)15-12-7-8-6-11(12)10-5-3-4-9(8)10;1-2-9-7-4-5-8(6-7)10(9)3-1;1-2/h2-3,5,8-12H,1,4,6-7H2;1-2,7-10H,3-6H2;2H,1H3 |
| InChIKey | BMAMSFACSAFRNR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|