C10H14 — CID 12592101
(1S,2R,6R,7S)-tricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 12592101) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (1S,2R,6R,7S)-tricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | (1S,2R,6R,7S)-tricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 12592101 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (1S,2R,6R,7S)-tricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C1=C[C@H]2[C@H]3CC[C@@H](C3)[C@H]2C1 |
| InChI | InChI=1S/C10H14/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,7-10H,3-6H2/t7-,8-,9-,10+/m0/s1 |
| InChIKey | HANKSFAYJLDDKP-AATLWQCWSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|