About tricyclo[5.4.1.02,6]dodec-4-en-9-ol
tricyclo[5.4.1.02,6]dodec-4-en-9-ol (PubChem CID 163650056) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is tricyclo[5.4.1.02,6]dodec-4-en-9-ol.
Molecular Properties
| Compound Name | tricyclo[5.4.1.02,6]dodec-4-en-9-ol |
| PubChem CID | 163650056 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | tricyclo[5.4.1.02,6]dodec-4-en-9-ol |
| SMILES | OC1CCC2CC(C1)C1C=CCC21 |
| InChI | InChI=1S/C12H18O/c13-10-5-4-8-6-9(7-10)12-3-1-2-11(8)12/h1,3,8-13H,2,4-7H2 |
| InChIKey | ILMRFXCXCMCWBN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.4.1.02,6]dodec-4-en-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.4.1.02,6]dodec-4-en-9-ol?
The IUPAC name of tricyclo[5.4.1.02,6]dodec-4-en-9-ol (CID 163650056) is tricyclo[5.4.1.02,6]dodec-4-en-9-ol.
What is the SMILES notation for tricyclo[5.4.1.02,6]dodec-4-en-9-ol?
The canonical SMILES for tricyclo[5.4.1.02,6]dodec-4-en-9-ol is OC1CCC2CC(C1)C1C=CCC21.
What is the InChIKey of tricyclo[5.4.1.02,6]dodec-4-en-9-ol?
The InChIKey is ILMRFXCXCMCWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c13-10-5-4-8-6-9(7-10)12-3-1-2-11(8)12/h1,3,8-13H,2,4-7H2.
What are the key properties of tricyclo[5.4.1.02,6]dodec-4-en-9-ol?
tricyclo[5.4.1.02,6]dodec-4-en-9-ol has a molecular weight of 178.28 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.4.1.02,6]dodec-4-en-9-ol is sourced from PubChem (CID 163650056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).