C21H38 — CID 91063776
ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-10-ene (PubChem CID 91063776) has the molecular formula C21H38 and a molecular weight of 290.53 g/mol. Its IUPAC name is ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-10-ene.
| Compound Name | ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-10-ene |
|---|---|
| PubChem CID | 91063776 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-10-ene |
| SMILES | C1=CC2C(C1)C1CC2C2C3CCC(C3)C12.CC.CC.CC |
| InChI | InChI=1S/C15H20.3C2H6/c1-2-10-11(3-1)13-7-12(10)14-8-4-5-9(6-8)15(13)14;3*1-2/h1-2,8-15H,3-7H2;3*1-2H3 |
| InChIKey | DBVLCMQLFHYBNT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|