C15H18 — CID 169451262
(1S,3R,6S)-pentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene (PubChem CID 169451262) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1S,3R,6S)-pentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene.
| Compound Name | (1S,3R,6S)-pentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene |
|---|---|
| PubChem CID | 169451262 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (1S,3R,6S)-pentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene |
| SMILES | C1=CC2C3C[C@@H](C2C1)C1C3[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H18/c1-2-10-11(3-1)13-7-12(10)14-8-4-5-9(6-8)15(13)14/h1-2,4-5,8-15H,3,6-7H2/t8-,9+,10?,11?,12?,13+,14?,15?/m1/s1 |
| InChIKey | XCGKRTHKVBCXLN-RHDPGYFOSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|