C15H20 — CID 14458344
pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene (PubChem CID 14458344) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene.
| Compound Name | pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene |
|---|---|
| PubChem CID | 14458344 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene |
| SMILES | C1=CC2CC1C1C3CC(C4CCCC43)C21 |
| InChI | InChI=1S/C15H20/c1-2-10-11(3-1)13-7-12(10)14-8-4-5-9(6-8)15(13)14/h4-5,8-15H,1-3,6-7H2 |
| InChIKey | VGXOXHRUFVBLBN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|