C14H22 — CID 59653739
8,9-diethyltricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 59653739) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 8,9-diethyltricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | 8,9-diethyltricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 59653739 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 8,9-diethyltricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | CCC1C2CC(C3CC=CC23)C1CC |
| InChI | InChI=1S/C14H22/c1-3-9-10(4-2)14-8-13(9)11-6-5-7-12(11)14/h5-6,9-14H,3-4,7-8H2,1-2H3 |
| InChIKey | VJIYVBVNHMUSEH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|