C16H24O3 — CID 15508538
[9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol (PubChem CID 15508538) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol.
| Compound Name | [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol |
|---|---|
| PubChem CID | 15508538 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol |
| SMILES | C=COCCOCC1C(CO)C2CC1C1CC=CC21 |
| InChI | InChI=1S/C16H24O3/c1-2-18-6-7-19-10-16-14-8-13(15(16)9-17)11-4-3-5-12(11)14/h2-4,11-17H,1,5-10H2 |
| InChIKey | QIAHBOOSLXHMJD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|