About [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol
[9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol (PubChem CID 15508538) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol.
Molecular Properties
| Compound Name | [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol |
| PubChem CID | 15508538 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol |
| SMILES | C=COCCOCC1C(CO)C2CC1C1CC=CC21 |
| InChI | InChI=1S/C16H24O3/c1-2-18-6-7-19-10-16-14-8-13(15(16)9-17)11-4-3-5-12(11)14/h2-4,11-17H,1,5-10H2 |
| InChIKey | QIAHBOOSLXHMJD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol?
The IUPAC name of [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol (CID 15508538) is [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol.
What is the SMILES notation for [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol?
The canonical SMILES for [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol is C=COCCOCC1C(CO)C2CC1C1CC=CC21.
What is the InChIKey of [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol?
The InChIKey is QIAHBOOSLXHMJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-2-18-6-7-19-10-16-14-8-13(15(16)9-17)11-4-3-5-12(11)14/h2-4,11-17H,1,5-10H2.
What are the key properties of [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol?
[9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol has a molecular weight of 264.36 g/mol, XLogP of 2.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(2-ethenoxyethoxymethyl)-8-tricyclo[5.2.1.02,6]dec-4-enyl]methanol is sourced from PubChem (CID 15508538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).