C12H18O2 — CID 15508536
[9-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]dec-3-enyl]methanol (PubChem CID 15508536) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is [9-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]dec-3-enyl]methanol.
| Compound Name | [9-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]dec-3-enyl]methanol |
|---|---|
| PubChem CID | 15508536 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | [9-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]dec-3-enyl]methanol |
| SMILES | OCC1C2CC(C3CC=CC23)C1CO |
| InChI | InChI=1S/C12H18O2/c13-5-11-9-4-10(12(11)6-14)8-3-1-2-7(8)9/h1-2,7-14H,3-6H2 |
| InChIKey | LBNZKSLEAKXWLQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|