C7H12O2 — CID 11094632
(1S,5S)-5-(hydroxymethyl)cyclohex-2-en-1-ol (PubChem CID 11094632) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (1S,5S)-5-(hydroxymethyl)cyclohex-2-en-1-ol.
| Compound Name | (1S,5S)-5-(hydroxymethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11094632 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (1S,5S)-5-(hydroxymethyl)cyclohex-2-en-1-ol |
| SMILES | OC[C@H]1CC=C[C@@H](O)C1 |
| InChI | InChI=1S/C7H12O2/c8-5-6-2-1-3-7(9)4-6/h1,3,6-9H,2,4-5H2/t6-,7+/m0/s1 |
| InChIKey | JMVASHRLICGBHU-NKWVEPMBSA-N |
| XLogP | 0.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|