C14H21Al — CID 177478102
(1R,7S,8R,12S)-3-ethyl-3-aluminatetracyclo[5.5.1.02,6.08,12]tridec-9-ene (PubChem CID 177478102) has the molecular formula C14H21Al and a molecular weight of 216.30 g/mol. Its IUPAC name is (1R,7S,8R,12S)-3-ethyl-3-aluminatetracyclo[5.5.1.02,6.08,12]tridec-9-ene.
| Compound Name | (1R,7S,8R,12S)-3-ethyl-3-aluminatetracyclo[5.5.1.02,6.08,12]tridec-9-ene |
|---|---|
| PubChem CID | 177478102 |
| Molecular Formula | C14H21Al |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1R,7S,8R,12S)-3-ethyl-3-aluminatetracyclo[5.5.1.02,6.08,12]tridec-9-ene |
| SMILES | CC[Al]1CCC2C1[C@@H]1C[C@H]2[C@@H]2C=CC[C@@H]21 |
| InChI | InChI=1S/C12H16.C2H5.Al/c1-2-8-6-9-7-12(8)11-5-3-4-10(9)11;1-2;/h3,5-6,8-12H,1-2,4,7H2;1H2,2H3;/t8?,9-,10-,11-,12-;;/m1../s1 |
| InChIKey | VGJYZNZFFVCJIX-FBARWVIOSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|