C18H24O2 — CID 102096680
4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-11-enyl propanoate (PubChem CID 102096680) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-11-enyl propanoate.
| Compound Name | 4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-11-enyl propanoate |
|---|---|
| PubChem CID | 102096680 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadec-11-enyl propanoate |
| SMILES | CCC(=O)OC1CC2CC1C1C3CC(C4CC=CC43)C21 |
| InChI | InChI=1S/C18H24O2/c1-2-16(19)20-15-7-9-6-14(15)18-13-8-12(17(9)18)10-4-3-5-11(10)13/h3,5,9-15,17-18H,2,4,6-8H2,1H3 |
| InChIKey | WHORGYCPYIWBIP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|