C14H22O4 — CID 175420870
[4,7-bis(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl] propanoate (PubChem CID 175420870) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [4,7-bis(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl] propanoate.
| Compound Name | [4,7-bis(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl] propanoate |
|---|---|
| PubChem CID | 175420870 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [4,7-bis(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl] propanoate |
| SMILES | CCC(=O)OC1CC(CO)C2C=CCC2C1CO |
| InChI | InChI=1S/C14H22O4/c1-2-14(17)18-13-6-9(7-15)10-4-3-5-11(10)12(13)8-16/h3-4,9-13,15-16H,2,5-8H2,1H3 |
| InChIKey | PNCOCFSNGYZYJH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|