C12H18 — CID 177450624
(1R,2S,6S,7R,8R)-8-ethyltricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 177450624) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (1R,2S,6S,7R,8R)-8-ethyltricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | (1R,2S,6S,7R,8R)-8-ethyltricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 177450624 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (1R,2S,6S,7R,8R)-8-ethyltricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | CC[C@@H]1C[C@@H]2C[C@H]1[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C12H18/c1-2-8-6-9-7-12(8)11-5-3-4-10(9)11/h3-4,8-12H,2,5-7H2,1H3/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | TVLDISKBYLQBLO-LZQZFOIKSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|