C11H16 — CID 14143162
tricyclo[5.4.0.02,8]undec-9-ene (PubChem CID 14143162) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is tricyclo[5.4.0.02,8]undec-9-ene.
| Compound Name | tricyclo[5.4.0.02,8]undec-9-ene |
|---|---|
| PubChem CID | 14143162 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | tricyclo[5.4.0.02,8]undec-9-ene |
| SMILES | C1=CC2C3CCCCC2C3C1 |
| InChI | InChI=1S/C11H16/c1-2-5-9-10-6-3-7-11(9)8(10)4-1/h3,6,8-11H,1-2,4-5,7H2 |
| InChIKey | UTNSWKMJYKCXSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|