C13H20 — CID 57381599
(1S,2R,7S,8R)-tricyclo[6.5.0.02,7]tridec-3-ene (PubChem CID 57381599) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (1S,2R,7S,8R)-tricyclo[6.5.0.02,7]tridec-3-ene.
| Compound Name | (1S,2R,7S,8R)-tricyclo[6.5.0.02,7]tridec-3-ene |
|---|---|
| PubChem CID | 57381599 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (1S,2R,7S,8R)-tricyclo[6.5.0.02,7]tridec-3-ene |
| SMILES | C1=C[C@H]2[C@@H](CC1)[C@@H]1CCCCC[C@H]21 |
| InChI | InChI=1S/C13H20/c1-2-6-10-11(7-3-1)13-9-5-4-8-12(10)13/h4,8,10-13H,1-3,5-7,9H2/t10-,11+,12+,13-/m0/s1 |
| InChIKey | CVUUDXGOMBTJLJ-LOWDOPEQSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|