C18H28 — CID 22256271
1,2,3,4,4a,4b,5,6,6a,9,10,10a,10b,11,12,12a-hexadecahydrochrysene (PubChem CID 22256271) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6,6a,9,10,10a,10b,11,12,12a-hexadecahydrochrysene.
| Compound Name | 1,2,3,4,4a,4b,5,6,6a,9,10,10a,10b,11,12,12a-hexadecahydrochrysene |
|---|---|
| PubChem CID | 22256271 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6,6a,9,10,10a,10b,11,12,12a-hexadecahydrochrysene |
| SMILES | C1=CC2CCC3C4CCCCC4CCC3C2CC1 |
| InChI | InChI=1S/C18H28/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1,5,13-18H,2-4,6-12H2 |
| InChIKey | MICCPPZAXCOBQU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|