About (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene
(3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene (PubChem CID 22138459) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene.
Molecular Properties
| Compound Name | (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene |
| PubChem CID | 22138459 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene |
| SMILES | C1=CC2CC1C1/C=C\CCCCC21 |
| InChI | InChI=1S/C13H18/c1-2-4-6-13-11-8-7-10(9-11)12(13)5-3-1/h3,5,7-8,10-13H,1-2,4,6,9H2/b5-3- |
| InChIKey | WMSDJFAJTGHTLL-HYXAFXHYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene?
The IUPAC name of (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene (CID 22138459) is (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene.
What is the SMILES notation for (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene?
The canonical SMILES for (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene is C1=CC2CC1C1/C=C\CCCCC21.
What is the InChIKey of (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene?
The InChIKey is WMSDJFAJTGHTLL-HYXAFXHYSA-N. The full InChI is InChI=1S/C13H18/c1-2-4-6-13-11-8-7-10(9-11)12(13)5-3-1/h3,5,7-8,10-13H,1-2,4,6,9H2/b5-3-.
What are the key properties of (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene?
(3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene has a molecular weight of 174.29 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene is sourced from PubChem (CID 22138459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).