C13H18 — CID 22138459
(3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene (PubChem CID 22138459) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene.
| Compound Name | (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene |
|---|---|
| PubChem CID | 22138459 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3Z)-tricyclo[8.2.1.02,9]trideca-3,11-diene |
| SMILES | C1=CC2CC1C1/C=C\CCCCC21 |
| InChI | InChI=1S/C13H18/c1-2-4-6-13-11-8-7-10(9-11)12(13)5-3-1/h3,5,7-8,10-13H,1-2,4,6,9H2/b5-3- |
| InChIKey | WMSDJFAJTGHTLL-HYXAFXHYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|