C12H14 — CID 142046940
tetracyclo[6.4.0.02,4.04,7]dodeca-5,9-diene (PubChem CID 142046940) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is tetracyclo[6.4.0.02,4.04,7]dodeca-5,9-diene.
| Compound Name | tetracyclo[6.4.0.02,4.04,7]dodeca-5,9-diene |
|---|---|
| PubChem CID | 142046940 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | tetracyclo[6.4.0.02,4.04,7]dodeca-5,9-diene |
| SMILES | C1=CC2C(CC1)C1CC13C=CC23 |
| InChI | InChI=1S/C12H14/c1-2-4-9-8(3-1)10-5-6-12(10)7-11(9)12/h1,3,5-6,8-11H,2,4,7H2 |
| InChIKey | UPDKALGYXATDGK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|