C11H18 — CID 23572815
1,3-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-indene (PubChem CID 23572815) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is 1,3-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-indene.
| Compound Name | 1,3-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
|---|---|
| PubChem CID | 23572815 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 1,3-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
| SMILES | CC1CC(C)C2CCC=CC12 |
| InChI | InChI=1S/C11H18/c1-8-7-9(2)11-6-4-3-5-10(8)11/h3,5,8-11H,4,6-7H2,1-2H3 |
| InChIKey | YEZKPXMRMKNLNA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|