C21H32 — CID 162270139
2-methyl-1-[(2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-1-yl)methyl]-2,3,3a,4,5,7a-hexahydro-1H-indene (PubChem CID 162270139) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-1-yl)methyl]-2,3,3a,4,5,7a-hexahydro-1H-indene.
| Compound Name | 2-methyl-1-[(2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-1-yl)methyl]-2,3,3a,4,5,7a-hexahydro-1H-indene |
|---|---|
| PubChem CID | 162270139 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2-methyl-1-[(2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-1-yl)methyl]-2,3,3a,4,5,7a-hexahydro-1H-indene |
| SMILES | CC1CC2CCC=CC2C1CC1C(C)CC2CCC=CC21 |
| InChI | InChI=1S/C21H32/c1-14-11-16-7-3-5-9-18(16)20(14)13-21-15(2)12-17-8-4-6-10-19(17)21/h5-6,9-10,14-21H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | RYYYOTHPQOIFQA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|