C12H21N — CID 88719545
1,2-diethyl-2,3,3a,4,5,7a-hexahydroindole (PubChem CID 88719545) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1,2-diethyl-2,3,3a,4,5,7a-hexahydroindole.
| Compound Name | 1,2-diethyl-2,3,3a,4,5,7a-hexahydroindole |
|---|---|
| PubChem CID | 88719545 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1,2-diethyl-2,3,3a,4,5,7a-hexahydroindole |
| SMILES | CCC1CC2CCC=CC2N1CC |
| InChI | InChI=1S/C12H21N/c1-3-11-9-10-7-5-6-8-12(10)13(11)4-2/h6,8,10-12H,3-5,7,9H2,1-2H3 |
| InChIKey | UZBRGNOUTUNNBU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|