C11H19N — CID 170221751
4-ethyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine (PubChem CID 170221751) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-ethyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine.
| Compound Name | 4-ethyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine |
|---|---|
| PubChem CID | 170221751 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-ethyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine |
| SMILES | CCC1CCCC2C=CCCN21 |
| InChI | InChI=1S/C11H19N/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3,6,10-11H,2,4-5,7-9H2,1H3 |
| InChIKey | HDGKNXAMUKVKAC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|