C13H24N2 — CID 114620565
(1-cyclohex-2-en-1-yl-6-methylpiperidin-2-yl)methanamine (PubChem CID 114620565) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (1-cyclohex-2-en-1-yl-6-methylpiperidin-2-yl)methanamine.
| Compound Name | (1-cyclohex-2-en-1-yl-6-methylpiperidin-2-yl)methanamine |
|---|---|
| PubChem CID | 114620565 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (1-cyclohex-2-en-1-yl-6-methylpiperidin-2-yl)methanamine |
| SMILES | CC1CCCC(CN)N1C1C=CCCC1 |
| InChI | InChI=1S/C13H24N2/c1-11-6-5-9-13(10-14)15(11)12-7-3-2-4-8-12/h3,7,11-13H,2,4-6,8-10,14H2,1H3 |
| InChIKey | YRWKIWSRNCMDEG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|