C11H16 — CID 102232466
(1S,6R,8S)-8-cyclopropylbicyclo[4.2.0]oct-2-ene (PubChem CID 102232466) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (1S,6R,8S)-8-cyclopropylbicyclo[4.2.0]oct-2-ene.
| Compound Name | (1S,6R,8S)-8-cyclopropylbicyclo[4.2.0]oct-2-ene |
|---|---|
| PubChem CID | 102232466 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1S,6R,8S)-8-cyclopropylbicyclo[4.2.0]oct-2-ene |
| SMILES | C1=C[C@@H]2[C@H](CC1)C[C@H]2C1CC1 |
| InChI | InChI=1S/C11H16/c1-2-4-10-9(3-1)7-11(10)8-5-6-8/h2,4,8-11H,1,3,5-7H2/t9-,10-,11+/m1/s1 |
| InChIKey | CVQNCSUIMFYGLM-MXWKQRLJSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|