C13H21N — CID 89395462
1-methyl-2,3,4,4a,4b,7,8,8a,9,9a-decahydro-1H-carbazole (PubChem CID 89395462) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-methyl-2,3,4,4a,4b,7,8,8a,9,9a-decahydro-1H-carbazole.
| Compound Name | 1-methyl-2,3,4,4a,4b,7,8,8a,9,9a-decahydro-1H-carbazole |
|---|---|
| PubChem CID | 89395462 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-methyl-2,3,4,4a,4b,7,8,8a,9,9a-decahydro-1H-carbazole |
| SMILES | CC1CCCC2C3C=CCCC3NC12 |
| InChI | InChI=1S/C13H21N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2,6,9-14H,3-5,7-8H2,1H3 |
| InChIKey | VMIXRAQVWQLTSU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|