C18H18O — CID 10106166
phenyl-[(1R,2S,6S,7S,8S,9R,10R)-9-tetracyclo[5.3.1.02,6.08,10]undec-3-enyl]methanone (PubChem CID 10106166) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is phenyl-[(1R,2S,6S,7S,8S,9R,10R)-9-tetracyclo[5.3.1.02,6.08,10]undec-3-enyl]methanone.
| Compound Name | phenyl-[(1R,2S,6S,7S,8S,9R,10R)-9-tetracyclo[5.3.1.02,6.08,10]undec-3-enyl]methanone |
|---|---|
| PubChem CID | 10106166 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | phenyl-[(1R,2S,6S,7S,8S,9R,10R)-9-tetracyclo[5.3.1.02,6.08,10]undec-3-enyl]methanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H]2[C@H]3C[C@H]([C@H]4C=CC[C@H]43)[C@@H]12 |
| InChI | InChI=1S/C18H18O/c19-18(10-5-2-1-3-6-10)17-15-13-9-14(16(15)17)12-8-4-7-11(12)13/h1-7,11-17H,8-9H2/t11-,12+,13+,14-,15+,16-,17-/m0/s1 |
| InChIKey | LANSMEQZKBDYGF-YDLMYCGBSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|