C24H20O — CID 154708999
phenyl-[(1S,8R,9S,10R)-10-phenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]methanone (PubChem CID 154708999) has the molecular formula C24H20O and a molecular weight of 324.42 g/mol. Its IUPAC name is phenyl-[(1S,8R,9S,10R)-10-phenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]methanone.
| Compound Name | phenyl-[(1S,8R,9S,10R)-10-phenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]methanone |
|---|---|
| PubChem CID | 154708999 |
| Molecular Formula | C24H20O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | phenyl-[(1S,8R,9S,10R)-10-phenyl-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]methanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](c2ccccc2)[C@@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C24H20O/c25-24(17-11-5-2-6-12-17)23-21-15-20(18-13-7-8-14-19(18)21)22(23)16-9-3-1-4-10-16/h1-14,20-23H,15H2/t20-,21+,22-,23+/m1/s1 |
| InChIKey | WKSYBYRQEXWXRV-ACESQOTJSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |