C25H32O8 — CID 77389674
[4-(3-ethoxy-3-oxoprop-1-enyl)phenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]cyclohexane-1-carboxylate (PubChem CID 77389674) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is [4-(3-ethoxy-3-oxoprop-1-enyl)phenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]cyclohexane-1-carboxylate.
| Compound Name | [4-(3-ethoxy-3-oxoprop-1-enyl)phenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 77389674 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [4-(3-ethoxy-3-oxoprop-1-enyl)phenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCOCCOC1CCC(C(=O)Oc2ccc(C=CC(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C25H32O8/c1-3-23(26)32-18-16-29-15-17-31-21-12-8-20(9-13-21)25(28)33-22-10-5-19(6-11-22)7-14-24(27)30-4-2/h3,5-7,10-11,14,20-21H,1,4,8-9,12-13,15-18H2,2H3 |
| InChIKey | JSNNCVVDVCZPSQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|