C32H42N2O5 — CID 68611620
[4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-hept-6-enoxycyclohexane-1-carboxylate (PubChem CID 68611620) has the molecular formula C32H42N2O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is [4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-hept-6-enoxycyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-hept-6-enoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68611620 |
| Molecular Formula | C32H42N2O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | [4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-hept-6-enoxycyclohexane-1-carboxylate |
| SMILES | C=CCCCCCOC1CCC(C(=O)Oc2ccc(/C=C/C(=O)OCC(C)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C32H42N2O5/c1-3-4-5-6-7-18-37-29-15-11-25(12-16-29)32(36)39-30-13-8-24(9-14-30)10-17-31(35)38-22-23(2)26-19-27(33)21-28(34)20-26/h3,8-10,13-14,17,19-21,23,25,29H,1,4-7,11-12,15-16,18,22,33-34H2,2H3/b17-10+ |
| InChIKey | PLHIROXAUCHCOG-LICLKQGHSA-N |
| XLogP | 6.44 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|