C29H38N2O5 — CID 91234403
[4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-hexoxycyclohexane-1-carboxylate (PubChem CID 91234403) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is [4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-hexoxycyclohexane-1-carboxylate.
| Compound Name | [4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-hexoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91234403 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | [4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-hexoxycyclohexane-1-carboxylate |
| SMILES | CCCCCCOC1CCC(C(=O)Oc2ccc(C=CC(=O)OCc3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C29H38N2O5/c1-2-3-4-5-18-34-25-15-10-22(11-16-25)29(33)36-26-13-6-21(7-14-26)8-17-28(32)35-20-23-9-12-24(30)19-27(23)31/h6-9,12-14,17,19,22,25H,2-5,10-11,15-16,18,20,30-31H2,1H3 |
| InChIKey | PSJYRYUBWGVSMC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|