C26H32N2O5 — CID 91469767
[4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-propoxycyclohexane-1-carboxylate (PubChem CID 91469767) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is [4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-propoxycyclohexane-1-carboxylate.
| Compound Name | [4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-propoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91469767 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [4-[3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-propoxycyclohexane-1-carboxylate |
| SMILES | CCCOC1CCC(C(=O)Oc2ccc(C=CC(=O)OCc3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C26H32N2O5/c1-2-15-31-22-12-7-19(8-13-22)26(30)33-23-10-3-18(4-11-23)5-14-25(29)32-17-20-6-9-21(27)16-24(20)28/h3-6,9-11,14,16,19,22H,2,7-8,12-13,15,17,27-28H2,1H3 |
| InChIKey | XPRYWVUDJNKHEM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|