C32H44N2O5 — CID 90694792
(4-heptoxycyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 90694792) has the molecular formula C32H44N2O5 and a molecular weight of 536.71 g/mol. Its IUPAC name is (4-heptoxycyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-heptoxycyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 90694792 |
| Molecular Formula | C32H44N2O5 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | (4-heptoxycyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCCCCCCOC1CCC(OC(=O)c2ccc(C=CC(=O)OCC(C)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C32H44N2O5/c1-3-4-5-6-7-18-37-29-13-15-30(16-14-29)39-32(36)25-11-8-24(9-12-25)10-17-31(35)38-22-23(2)26-19-27(33)21-28(34)20-26/h8-12,17,19-21,23,29-30H,3-7,13-16,18,22,33-34H2,1-2H3 |
| InChIKey | JQUVNIUIHVBRRF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|