C30H37F3N2O5 — CID 90896056
[4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 90896056) has the molecular formula C30H37F3N2O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | [4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 90896056 |
| Molecular Formula | C30H37F3N2O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCCCC(COC(=O)C=Cc1ccc(C(=O)OC2CCC(OCC(F)(F)F)CC2)cc1)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C30H37F3N2O5/c1-2-3-4-22(23-15-24(34)17-25(35)16-23)18-38-28(36)14-7-20-5-8-21(9-6-20)29(37)40-27-12-10-26(11-13-27)39-19-30(31,32)33/h5-9,14-17,22,26-27H,2-4,10-13,18-19,34-35H2,1H3 |
| InChIKey | XYHRIJJPUDTTPV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|