C33H46N2O5 — CID 68613237
(4-pentoxycyclohexyl) 4-[(E)-3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 68613237) has the molecular formula C33H46N2O5 and a molecular weight of 550.74 g/mol. Its IUPAC name is (4-pentoxycyclohexyl) 4-[(E)-3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-pentoxycyclohexyl) 4-[(E)-3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 68613237 |
| Molecular Formula | C33H46N2O5 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | (4-pentoxycyclohexyl) 4-[(E)-3-[2-(3,5-diaminophenyl)hexoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCCCCOC1CCC(OC(=O)c2ccc(/C=C/C(=O)OCC(CCCC)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C33H46N2O5/c1-3-5-7-19-38-30-14-16-31(17-15-30)40-33(37)25-12-9-24(10-13-25)11-18-32(36)39-23-26(8-6-4-2)27-20-28(34)22-29(35)21-27/h9-13,18,20-22,26,30-31H,3-8,14-17,19,23,34-35H2,1-2H3/b18-11+ |
| InChIKey | XUOOULPYXQTBOH-WOJGMQOQSA-N |
| XLogP | 7.06 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|