C30H38N2O5 — CID 68612868
(4-hex-5-enoxycyclohexyl) 4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 68612868) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is (4-hex-5-enoxycyclohexyl) 4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-hex-5-enoxycyclohexyl) 4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 68612868 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | (4-hex-5-enoxycyclohexyl) 4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | C=CCCCCOC1CCC(OC(=O)c2ccc(/C=C/C(=O)OCCc3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C30H38N2O5/c1-2-3-4-5-19-35-26-13-15-27(16-14-26)37-30(34)24-9-6-22(7-10-24)8-17-29(33)36-20-18-23-11-12-25(31)21-28(23)32/h2,6-12,17,21,26-27H,1,3-5,13-16,18-20,31-32H2/b17-8+ |
| InChIKey | SIUGXGOJBBJFIH-CAOOACKPSA-N |
| XLogP | 5.49 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|