C19H22O5 — CID 68611169
(E)-3-[4-(4-prop-2-enoxycyclohexyl)oxycarbonylphenyl]prop-2-enoic acid (PubChem CID 68611169) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (E)-3-[4-(4-prop-2-enoxycyclohexyl)oxycarbonylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(4-prop-2-enoxycyclohexyl)oxycarbonylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68611169 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (E)-3-[4-(4-prop-2-enoxycyclohexyl)oxycarbonylphenyl]prop-2-enoic acid |
| SMILES | C=CCOC1CCC(OC(=O)c2ccc(/C=C/C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C19H22O5/c1-2-13-23-16-8-10-17(11-9-16)24-19(22)15-6-3-14(4-7-15)5-12-18(20)21/h2-7,12,16-17H,1,8-11,13H2,(H,20,21)/b12-5+ |
| InChIKey | LIHYSAZFCNSUAU-LFYBBSHMSA-N |
| XLogP | 3.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|