C31H40N2O4 — CID 68611043
(4-oct-7-enylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 68611043) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is (4-oct-7-enylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-oct-7-enylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 68611043 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | (4-oct-7-enylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | C=CCCCCCCC1CCC(OC(=O)c2ccc(/C=C/C(=O)OCc3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C31H40N2O4/c1-2-3-4-5-6-7-8-23-11-16-29(17-12-23)37-31(35)26-14-9-24(10-15-26)13-18-30(34)36-22-25-19-27(32)21-28(33)20-25/h2,9-10,13-15,18-21,23,29H,1,3-8,11-12,16-17,22,32-33H2/b18-13+ |
| InChIKey | UUYQEIJCLGIOPZ-QGOAFFKASA-N |
| XLogP | 6.85 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|