C23H28O4 — CID 11025012
(1R,9R,10R,14R)-6-ethenyl-12,12-dimethyl-9-phenylmethoxy-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadec-3-ene (PubChem CID 11025012) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (1R,9R,10R,14R)-6-ethenyl-12,12-dimethyl-9-phenylmethoxy-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadec-3-ene.
| Compound Name | (1R,9R,10R,14R)-6-ethenyl-12,12-dimethyl-9-phenylmethoxy-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadec-3-ene |
|---|---|
| PubChem CID | 11025012 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R,9R,10R,14R)-6-ethenyl-12,12-dimethyl-9-phenylmethoxy-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadec-3-ene |
| SMILES | C=CC1CC=CC2C1C[C@@]1(OCc3ccccc3)[C@@H]2O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C23H28O4/c1-4-16-11-8-12-17-18(16)13-23(24-14-15-9-6-5-7-10-15)19(17)25-21-20(23)26-22(2,3)27-21/h4-10,12,16-21H,1,11,13-14H2,2-3H3/t16?,17?,18?,19-,20+,21-,23-/m1/s1 |
| InChIKey | QNMQRMRUARRDDS-YFFPVADCSA-N |
| XLogP | 4.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|