C19H24O5 — CID 15545581
(1R,2R,6R,8R,11R)-1,4,4-trimethyl-11-phenylmethoxy-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridec-9-ene (PubChem CID 15545581) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1R,2R,6R,8R,11R)-1,4,4-trimethyl-11-phenylmethoxy-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridec-9-ene.
| Compound Name | (1R,2R,6R,8R,11R)-1,4,4-trimethyl-11-phenylmethoxy-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridec-9-ene |
|---|---|
| PubChem CID | 15545581 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (1R,2R,6R,8R,11R)-1,4,4-trimethyl-11-phenylmethoxy-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridec-9-ene |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C=C[C@@H](OCc4ccccc4)CO[C@@]3(C)[C@H]2O1 |
| InChI | InChI=1S/C19H24O5/c1-18(2)23-16-17(24-18)22-15-10-9-14(12-21-19(15,16)3)20-11-13-7-5-4-6-8-13/h4-10,14-17H,11-12H2,1-3H3/t14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | LELDTYRNMXCSPZ-OGJJZOIMSA-N |
| XLogP | 2.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|