C32H36O7 — CID 11060496
(1R,2S,6R,8R,9R,10R)-4,4-dimethyl-1,9-bis(phenylmethoxy)-10-(phenylmethoxymethyl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 11060496) has the molecular formula C32H36O7 and a molecular weight of 532.63 g/mol. Its IUPAC name is (1R,2S,6R,8R,9R,10R)-4,4-dimethyl-1,9-bis(phenylmethoxy)-10-(phenylmethoxymethyl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1R,2S,6R,8R,9R,10R)-4,4-dimethyl-1,9-bis(phenylmethoxy)-10-(phenylmethoxymethyl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 11060496 |
| Molecular Formula | C32H36O7 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (1R,2S,6R,8R,9R,10R)-4,4-dimethyl-1,9-bis(phenylmethoxy)-10-(phenylmethoxymethyl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@H](OCc4ccccc4)[C@H](COCc4ccccc4)CO[C@]3(OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C32H36O7/c1-31(2)38-29-30(39-31)37-28-27(34-19-24-14-8-4-9-15-24)26(21-33-18-23-12-6-3-7-13-23)22-36-32(28,29)35-20-25-16-10-5-11-17-25/h3-17,26-30H,18-22H2,1-2H3/t26-,27-,28-,29+,30-,32+/m1/s1 |
| InChIKey | UQFWNVJSLVHHIK-HEVXCPBESA-N |
| XLogP | 5.22 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |