C25H30O5 — CID 25259331
(1S,3R,5R,7R,8Z,11S,12R,16R)-5-ethenyl-14,14-dimethyl-11-phenylmethoxy-13,15,17-trioxatetracyclo[9.6.0.03,7.012,16]heptadec-8-en-2-one (PubChem CID 25259331) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is (1S,3R,5R,7R,8Z,11S,12R,16R)-5-ethenyl-14,14-dimethyl-11-phenylmethoxy-13,15,17-trioxatetracyclo[9.6.0.03,7.012,16]heptadec-8-en-2-one.
| Compound Name | (1S,3R,5R,7R,8Z,11S,12R,16R)-5-ethenyl-14,14-dimethyl-11-phenylmethoxy-13,15,17-trioxatetracyclo[9.6.0.03,7.012,16]heptadec-8-en-2-one |
|---|---|
| PubChem CID | 25259331 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (1S,3R,5R,7R,8Z,11S,12R,16R)-5-ethenyl-14,14-dimethyl-11-phenylmethoxy-13,15,17-trioxatetracyclo[9.6.0.03,7.012,16]heptadec-8-en-2-one |
| SMILES | C=C[C@@H]1C[C@@H]2/C=C\C[C@@]3(OCc4ccccc4)[C@H](O[C@@H]4OC(C)(C)O[C@@H]43)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C25H30O5/c1-4-16-13-18-11-8-12-25(27-15-17-9-6-5-7-10-17)21(20(26)19(18)14-16)28-23-22(25)29-24(2,3)30-23/h4-11,16,18-19,21-23H,1,12-15H2,2-3H3/b11-8-/t16-,18+,19-,21-,22+,23-,25-/m1/s1 |
| InChIKey | FBTSQUXCNWQVRQ-BFQOZMRFSA-N |
| XLogP | 4.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|