C18H24O5 — CID 102259060
(1S,3R,5R,7R,8Z,12R,13R,17R)-5-ethenyl-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.03,7.013,17]octadec-8-en-2-one (PubChem CID 102259060) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (1S,3R,5R,7R,8Z,12R,13R,17R)-5-ethenyl-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.03,7.013,17]octadec-8-en-2-one.
| Compound Name | (1S,3R,5R,7R,8Z,12R,13R,17R)-5-ethenyl-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.03,7.013,17]octadec-8-en-2-one |
|---|---|
| PubChem CID | 102259060 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (1S,3R,5R,7R,8Z,12R,13R,17R)-5-ethenyl-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.03,7.013,17]octadec-8-en-2-one |
| SMILES | C=C[C@@H]1C[C@@H]2/C=C\CO[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C18H24O5/c1-4-10-8-11-6-5-7-20-15-14(13(19)12(11)9-10)21-17-16(15)22-18(2,3)23-17/h4-6,10-12,14-17H,1,7-9H2,2-3H3/b6-5-/t10-,11+,12-,14-,15+,16-,17-/m1/s1 |
| InChIKey | IMQOZCKDGSCYTH-HCRPCIOTSA-N |
| XLogP | 2.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|