C17H30O6Si — CID 101194126
(1S,2R,6R,8S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-9-one (PubChem CID 101194126) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is (1S,2R,6R,8S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-9-one.
| Compound Name | (1S,2R,6R,8S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-9-one |
|---|---|
| PubChem CID | 101194126 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S,2R,6R,8S,10S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-9-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(=O)[C@H](CO[Si](C)(C)C(C)(C)C)CO[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C17H30O6Si/c1-16(2,3)24(6,7)20-9-10-8-19-13-12(11(10)18)21-15-14(13)22-17(4,5)23-15/h10,12-15H,8-9H2,1-7H3/t10-,12+,13+,14+,15+/m0/s1 |
| InChIKey | HLMAGGAKNASJAI-URWOTSEESA-N |
| XLogP | 2.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|