C17H22O — CID 16726764
(2S,3aS,5aR,7R,8aR,9aS)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,9a-decahydrocyclopenta[f]azulen-9-one (PubChem CID 16726764) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S,3aS,5aR,7R,8aR,9aS)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,9a-decahydrocyclopenta[f]azulen-9-one.
| Compound Name | (2S,3aS,5aR,7R,8aR,9aS)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,9a-decahydrocyclopenta[f]azulen-9-one |
|---|---|
| PubChem CID | 16726764 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2S,3aS,5aR,7R,8aR,9aS)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,9a-decahydrocyclopenta[f]azulen-9-one |
| SMILES | C=C[C@@H]1C[C@@H]2C=C[C@@H]3C[C@H](C=C)C[C@@H]3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C17H22O/c1-3-11-7-13-5-6-14-8-12(4-2)10-16(14)17(18)15(13)9-11/h3-6,11-16H,1-2,7-10H2/t11-,12+,13+,14-,15-,16+ |
| InChIKey | SRWMALRMFGCEOM-ZUISRVRFSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|