C8H8Cl2O — CID 22489717
(2R,4S,5S)-2,4-dichlorobicyclo[3.2.1]oct-6-en-3-one (PubChem CID 22489717) has the molecular formula C8H8Cl2O and a molecular weight of 191.06 g/mol. Its IUPAC name is (2R,4S,5S)-2,4-dichlorobicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (2R,4S,5S)-2,4-dichlorobicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 22489717 |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | (2R,4S,5S)-2,4-dichlorobicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1[C@@H](Cl)[C@@H]2C=CC(C2)[C@H]1Cl |
| InChI | InChI=1S/C8H8Cl2O/c9-6-4-1-2-5(3-4)7(10)8(6)11/h1-2,4-7H,3H2/t4-,5?,6+,7-/m1/s1 |
| InChIKey | GGEOOKDRCNLDQS-ZFGFBIEISA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|