C7H8Cl2 — CID 23270288
(1R,4S,5R,6R)-5,6-dichlorobicyclo[2.2.1]hept-2-ene (PubChem CID 23270288) has the molecular formula C7H8Cl2 and a molecular weight of 163.05 g/mol. Its IUPAC name is (1R,4S,5R,6R)-5,6-dichlorobicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R,6R)-5,6-dichlorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 23270288 |
| Molecular Formula | C7H8Cl2 |
| Molecular Weight | 163.05 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | (1R,4S,5R,6R)-5,6-dichlorobicyclo[2.2.1]hept-2-ene |
| SMILES | Cl[C@H]1[C@H](Cl)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C7H8Cl2/c8-6-4-1-2-5(3-4)7(6)9/h1-2,4-7H,3H2/t4-,5+,6-,7-/m1/s1 |
| InChIKey | ZFSMTYOLNXPHEU-XZBKPIIZSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.05 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|